cas: 71904-80-8 — see every product listed under this CAS number, including other names
2-((TERT-BUTOXYCARBONYLAMINO)METHYL)THIAZOLE-4-CARBOXYLIC ACID, 95% (CAS 71904-80-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F470178-100MG |
| cas | 71904-80-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 534.20 Pln | |
| Fluorochem | 250mg | 851.80 Pln | |
| Fluorochem | 1g | 2174.25 Pln | |
| Fluorochem | 5g | 6667.46 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-4-carboxylic acid (CAS 71904-80-8) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: RKTDDQLCSYDRLH-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | RKTDDQLCSYDRLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC(=CS1)C(=O)O |
Computed by PubChem (NCBI)