cas: 71904-80-8 — see every product listed under this CAS number, including other names
2-[[(tert-butoxycarbonyl)amino]methyl]thiazole-4-carboxylic acid, 98%, 98% (CAS 71904-80-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1172GK-100mg |
| cas | 71904-80-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3165.20 Pln | |
| Chemat | 10g | 5714.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-4-carboxylic acid (CAS 71904-80-8) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: RKTDDQLCSYDRLH-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | RKTDDQLCSYDRLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC(=CS1)C(=O)O |
Computed by PubChem (NCBI)