cas: 13159-88-1 — see every product listed under this CAS number, including other names
2-((Thiazol-2-ylamino)methyl)phenol, 98% (CAS 13159-88-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F053656-250MG |
| cas | 13159-88-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 820.56 Pln | |
| Fluorochem | 5g | 2955.23 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[(1,3-thiazol-2-ylamino)methyl]phenol (CAS 13159-88-1) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 2-[(1,3-thiazol-2-ylamino)methyl]phenol. InChIKey: FUVLIIWCXQIRQM-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 2-[(1,3-thiazol-2-ylamino)methyl]phenol |
| InChIKey | FUVLIIWCXQIRQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=NC=CS2)O |
Computed by PubChem (NCBI)