2-((tert-Butoxycarbonyl)amino)-3-methoxypropanoic acid, 95%, 95%
cas: 856417-65-7 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)-3-methoxypropanoic acid, 95%, 95% (CAS 856417-65-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0SU-1g |
| cas | 856417-65-7 |
| size | 1g |
| availability | 300g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 434.00 Pln | |
| Chemat | 10g | 640.40 Pln | |
| Chemat | 25g | 1125.20 Pln | |
| Chemat | 100g | 2896.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 856417-65-7) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: 3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RFGMSGRWQUMJIR-UHFFFAOYSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | 3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RFGMSGRWQUMJIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(COC)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid, 2-(((tert-butoxy)carbonyl)amino)-3-methoxypropanoic acid, 2-[[(tert-Butoxy)carbonyl]amino]-3-methoxypropanoic acid, 2-((tert-butoxycarbonyl)amino)-3-methoxypropanoic acid, Boc-2-amino-3-methoxypropionic acid, Boc-O-methyl-DL-serine, N-(tert-butoxycarbonyl)-O-methylserine, 3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid, 2-[(tert-butoxycarbonyl)amino]-3-methoxypropanoic acid, Serine, N-[(1,1-dimethylethoxy)carbonyl]-O-methyl-