CAS 51293-47-1 appears in our catalog under these names: N–Boc–O–methyl–L–serine, Boc–Ser(Me)–OH, N-Boc-O-methyl-L-serine, 97% , Boc-Ser(Me)-OH, 97%, 97%, Boc-Ser(Me)-OH, 97.0%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100g, 25 g, 10 g.
(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 51293-47-1) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RFGMSGRWQUMJIR-LURJTMIESA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RFGMSGRWQUMJIR-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COC)C(=O)O |
Computed by PubChem (NCBI)