CAS 86123-95-7 appears in our catalog under these names: Boc-o-Methyl-D-serine, 95%, (R)–2–((tert–Butoxycarbonyl)amino)–3–methoxypropanoic acid, (R)-2-((tert-Butoxycarbonyl)amino)-3-methoxypropanoic acid, (R)-2-(tert-Butoxycarbonylamino)-3-methoxypropionic acid, 97%, 97%, Boc-D-Ser(Me)-OH, 97%. Offered by: Fluorochem, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 500g, 1kg.
(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 86123-95-7) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RFGMSGRWQUMJIR-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RFGMSGRWQUMJIR-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](COC)C(=O)O |
Computed by PubChem (NCBI)