2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, 98%
cas: 220760-49-6 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, 98% (CAS 220760-49-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A330899-100mg |
| cas | 220760-49-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 615.13 Pln | |
| Ambeed | 1g | 1282.62 Pln | |
| Ambeed | 5g | 4881.56 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 894.80 Pln | |
| Chemat | 5g | 3395.60 Pln | |
| BLDpharm | 100mg | 436.54 Pln | |
| BLDpharm | 250mg | 658.68 Pln | |
| BLDpharm | 1g | 1375.10 Pln | |
| BLDpharm | 5g | 5257.06 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 220760-49-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: QJEQJDJFJWWURK-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | QJEQJDJFJWWURK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCCCC1C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, Boc-2-amino-1-cyclohexanecarboxylic acid, 2-{[(tert-butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid, 2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic Acid, 2-(tert-butoxycarbonylamino)cyclohexanecarboxylic acid, 2-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylic acid, Boc-trans-2-aminocyclohexanecarboxylic acid, (1R,2S)-2-tert-Butoxycarbonylamino-cyclohexanecarboxylic acid, (1R,2R)-Boc-2-aminocyclohexane carboxylic acid, trans-2-tert-Butoxycarbonylaminocyclohexanecarboxylic acid