CAS 233661-54-6 appears in our catalog under these names: (1R,2R)-Boc-2-aminocyclohexane carboxylic acid, 95%, Boc-1,2-ACHC-OH (1R,2R), (1R,2R)-Boc-aminocyclohexane carboxylic acid, (1R,2R)-Boc-aminocyclohexane carboxylic acid 97%, (1R,2R)-2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, 97%, 97%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 0,1g, 0,25g, 0,5g, 25g.
Trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 233661-54-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: QJEQJDJFJWWURK-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | QJEQJDJFJWWURK-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)