CAS 352356-38-8 appears in our catalog under these names: (1R,2S)-Boc-2-aminocyclohexane carboxylic acid, 95%, Boc-1,2-ACHC-OH (1R,2S), (1R,2S)-Boc-Achc, (1R,2S)-Boc-Achc 95%, (1R,2S)-2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, 95%, 95%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
Cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 352356-38-8) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: QJEQJDJFJWWURK-BDAKNGLRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | cis-(1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | QJEQJDJFJWWURK-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)