cas: 158690-56-3 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)ethyl 4-methylbenzenesulfonate, 98%, 98% (CAS 158690-56-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112QRB-250mg |
| cas | 158690-56-3 |
| size | 250mg |
| availability | 228g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 50g | 856.40 Pln | |
| Chemat | 100g | 1442.00 Pln | |
| Chemat | 100mg | 83.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-methylbenzenesulfonate (CAS 158690-56-3) is a chemical compound with the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-methylbenzenesulfonate. InChIKey: OWNIGLWHXOENAA-UHFFFAOYSA-N.
| Molecular formula | C14H21NO5S |
|---|---|
| Molecular weight | 315.39 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-methylbenzenesulfonate |
| InChIKey | OWNIGLWHXOENAA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)