CAS 2097600-16-1 appears in our catalog under these names: Apremilast Impurity 101, Apremilast Impurity 58. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]acetamide (CAS 2097600-16-1) is a chemical compound with the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. IUPAC name: N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]acetamide. InChIKey: JXQHZPLOPHTQTK-GFCCVEGCSA-N.
| Molecular formula | C14H21NO5S |
|---|---|
| Molecular weight | 315.39 g/mol |
| IUPAC name | N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]acetamide |
| InChIKey | JXQHZPLOPHTQTK-GFCCVEGCSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](CS(=O)(=O)C)NC(=O)C)OC |
Computed by PubChem (NCBI)