CAS 158690-56-3 appears in our catalog under these names: 2-((tert-Butoxycarbonyl)amino)ethyl-d4 4-Methylbenzenesulfonate, 2-((tert-Butoxycarbonyl)amino)ethyl 4-methylbenzenesulfonate, 98%, 98%, 2-((tert-Butoxycarbonyl)amino)ethyl 4-methylbenzenesulfonate, 99.58%, 2-((tert-Butoxycarbonyl)amino)ethyl 4-methylbenzenesulfonate, 95%. Offered by: Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 2,5g, 0,25g, 250mg, 1g, 5g, 10g, 25g, 50g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-methylbenzenesulfonate (CAS 158690-56-3) is a chemical compound with the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-methylbenzenesulfonate. InChIKey: OWNIGLWHXOENAA-UHFFFAOYSA-N.
| Molecular formula | C14H21NO5S |
|---|---|
| Molecular weight | 315.39 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-methylbenzenesulfonate |
| InChIKey | OWNIGLWHXOENAA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)