Products 2757551-61-2

CAS 2757551-61-2 is the registry number for ethyl 2-(azetidin-3-yl)acetate,4-methylbenzenesulfonic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Ethyl 2-(azetidin-3-yl)acetate;4-methylbenzenesulfonic acid (CAS 2757551-61-2) is a chemical compound with the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. IUPAC name: ethyl 2-(azetidin-3-yl)acetate;4-methylbenzenesulfonic acid. InChIKey: KUCSYUMKGBCLTO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21NO5S
Molecular weight315.39 g/mol
IUPAC nameethyl 2-(azetidin-3-yl)acetate;4-methylbenzenesulfonic acid
InChIKeyKUCSYUMKGBCLTO-UHFFFAOYSA-N
SMILESCCOC(=O)CC1CNC1.CC1=CC=C(C=C1)S(=O)(=O)O

Computed by PubChem (NCBI)