Products 1231709-21-9
CAS 1231709-21-9 appears in our catalog under these names: Ethyl (S)-2-aminopent-4-enoate 4-methylbenzenesulfonate, 98%, (S)-alpha-Allylglycine ethyl ester p-toluenesulfonate, (S)-alpha-Allylglycine ethyl ester p-toluenesulfonate, 98%, 98% ee. Offered by: Chemat Brand, Creative Peptides, Thermo Scientific (Acros). Available pack sizes: on request, 1g, 5g.
Ethyl (2S)-2-aminopent-4-enoate;4-methylbenzenesulfonic acid (CAS 1231709-21-9) is a chemical compound with the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. IUPAC name: ethyl (2S)-2-aminopent-4-enoate;4-methylbenzenesulfonic acid. InChIKey: MEQLYDZSCPUCRY-RGMNGODLSA-N.
| Molecular formula | C14H21NO5S |
|---|---|
| Molecular weight | 315.39 g/mol |
| IUPAC name | ethyl (2S)-2-aminopent-4-enoate;4-methylbenzenesulfonic acid |
| InChIKey | MEQLYDZSCPUCRY-RGMNGODLSA-N |
| SMILES | CCOC(=O)[C@H](CC=C)N.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)