CAS 903094-60-0 appears in our catalog under these names: 2-((tert-Butoxycarbonyl)amino)oxazole-5-carboxylic acid, 98%, 98%, 2-{[(tert-Butoxy)carbonyl]amino}-1,3-oxazole-5-carboxylic acid, 98%, 2-((tert-Butoxycarbonyl)amino)oxazole-5-carboxylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazole-5-carboxylic acid (CAS 903094-60-0) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazole-5-carboxylic acid. InChIKey: GRSZRACHQGSPBM-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazole-5-carboxylic acid |
| InChIKey | GRSZRACHQGSPBM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(O1)C(=O)O |
Computed by PubChem (NCBI)