CAS 15958-99-3 appears in our catalog under these names: 5'-Deoxyuridine, 95%, 1–((2R,3R,4S,5R)–3,4–dihydroxy–5–methyltetrahydrofuran–2–yl)pyrimidine–2,4(1H,3H)–dione, 5'-Deoxyuridine, 5''-Deoxyuridine, 98.00%, 5'-Deoxyuridine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 25mg, 10mg, 50mg.
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione (CAS 15958-99-3) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. IUPAC name: 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione. InChIKey: WUBAOANSQGKRHF-XVFCMESISA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | WUBAOANSQGKRHF-XVFCMESISA-N |
| SMILES | C[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=CC(=O)NC2=O)O)O |
Computed by PubChem (NCBI)