CAS 31501-19-6 appears in our catalog under these names: 2'-Deoxy-l-uridine, 95%, 2′–Deoxy–β–L–uridine, 2'-Deoxy-L-uridine, 2′-Deoxy-β-L-uridine, 99.96%. Offered by: Combi-blocks, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 500mg, 2g, 250 mg, 100 mg, 500 mg.
1-[(2R,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 31501-19-6) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. IUPAC name: 1-[(2R,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: MXHRCPNRJAMMIM-GKROBHDKSA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 1-[(2R,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | MXHRCPNRJAMMIM-GKROBHDKSA-N |
| SMILES | C1[C@H]([C@@H](O[C@H]1N2C=CC(=O)NC2=O)CO)O |
Computed by PubChem (NCBI)