CAS 369656-76-8 appears in our catalog under these names: 2’-Deoxyuridine-13C,15N2, >95% (HPLC), 2'-Deoxyuridine-2-13C,1,3-15N2, 99 atom % 13C, 99 atom % 15N, min 98% Chemical Purity, 2′–Deoxyuridine–13C,1?N2, 2'-DEOXYURIDINE-13C,15N2, ≥95%, ≥95%, 2'-Deoxyuridine-13C,15N2, 98.08%. Offered by: TRC, CDN, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 0,01g, 1mg, 5mg, 5 mg, 1 mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl](213C,1,3-15N2)pyrimidine-2,4-dione (CAS 369656-76-8) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 231.18 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl](213C,1,3-15N2)pyrimidine-2,4-dione. InChIKey: MXHRCPNRJAMMIM-XPWHOUBVSA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 231.18 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl](213C,1,3-15N2)pyrimidine-2,4-dione |
| InChIKey | MXHRCPNRJAMMIM-XPWHOUBVSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1[15N]2C=CC(=O)[15NH][13C]2=O)CO)O |
Computed by PubChem (NCBI)