CAS 7057-27-4 appears in our catalog under these names: 3'-Deoxyuridine, 95%, 3’-Deoxy Uridine, 3′-Deoxyuridine, 98%, 3′–Deoxyuridine, 3′-Deoxyuridine. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, TargetMol. Available pack sizes: 250mg, 100mg, 1g, 25mg, 50mg, 2mg, 5mg, 500mg.
1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 7057-27-4) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. IUPAC name: 1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: QOXJRLADYHZRGC-SHYZEUOFSA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | QOXJRLADYHZRGC-SHYZEUOFSA-N |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=CC(=O)NC2=O)CO |
Computed by PubChem (NCBI)