cas: 39889-69-5 — see every product listed under this CAS number, including other names
2-([1,1'-Biphenyl]-4-yl)acetyl chloride, 95%, 95% (CAS 39889-69-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CN2F-100mg |
| cas | 39889-69-5 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1096.40 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-phenylphenyl)acetyl chloride (CAS 39889-69-5) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-(4-phenylphenyl)acetyl chloride. InChIKey: HWTMLSYLXGLSDF-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-(4-phenylphenyl)acetyl chloride |
| InChIKey | HWTMLSYLXGLSDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)Cl |
Computed by PubChem (NCBI)