cas: 57420-27-6 — see every product listed under this CAS number, including other names
2-(1,3-benzodioxol-5-ylmethyl)butanedioic acid, 95%, 95% (CAS 57420-27-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPN0-100mg |
| cas | 57420-27-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 1g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(1,3-benzodioxol-5-ylmethyl)butanedioic acid (CAS 57420-27-6) is a chemical compound with the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-ylmethyl)butanedioic acid. InChIKey: VXIGMHUBZXMCIU-UHFFFAOYSA-N.
| Molecular formula | C12H12O6 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-ylmethyl)butanedioic acid |
| InChIKey | VXIGMHUBZXMCIU-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CC(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)