Products 1346600-69-8
CAS 1346600-69-8 appears in our catalog under these names: Mono(3-carboxypropyl) Phthalate-d4, >95% (HPLC), Mono(3-carboxypropyl) phthalate-d4. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 10mg, 50mg, 2.5 mg.
2-(3-carboxypropoxycarbonyl)-3,4,5,6-tetradeuteriobenzoic acid (CAS 1346600-69-8) is a chemical compound with the molecular formula C12H12O6 and a molecular weight of 256.24 g/mol. IUPAC name: 2-(3-carboxypropoxycarbonyl)-3,4,5,6-tetradeuteriobenzoic acid. InChIKey: IYTPMLIWBZMBSL-GYABSUSNSA-N.
| Molecular formula | C12H12O6 |
|---|---|
| Molecular weight | 256.24 g/mol |
| IUPAC name | 2-(3-carboxypropoxycarbonyl)-3,4,5,6-tetradeuteriobenzoic acid |
| InChIKey | IYTPMLIWBZMBSL-GYABSUSNSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)