CAS 2999-40-8 appears in our catalog under these names: Pholoroglucinol triacetate, Phloroglucinol triacetate, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 10g, 25g, 50g, 100g, 250g.
(3,5-diacetyloxyphenyl) acetate (CAS 2999-40-8) is a chemical compound with the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. IUPAC name: (3,5-diacetyloxyphenyl) acetate. InChIKey: CLWKAMVDWLTMKD-UHFFFAOYSA-N.
| Molecular formula | C12H12O6 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | (3,5-diacetyloxyphenyl) acetate |
| InChIKey | CLWKAMVDWLTMKD-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)