CAS 1867923-49-6 appears in our catalog under these names: 2-(1-cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(1-Cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g, 2.5g, 25g.
2-(1-cyclopropylethenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1867923-49-6) is a chemical compound with the molecular formula C11H19BO2 and a molecular weight of 194.08 g/mol. IUPAC name: 2-(1-cyclopropylethenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DOGJSLVOGBGMJP-UHFFFAOYSA-N.
| Molecular formula | C11H19BO2 |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 2-(1-cyclopropylethenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DOGJSLVOGBGMJP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2CC2 |
Computed by PubChem (NCBI)