CAS 287944-10-9 appears in our catalog under these names: 1–Cyclopentenylboronic acid pinacol ester, 2-(1-Cyclopentenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC), 2-(Cyclopent-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(1-Cyclopenten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 1-Cyclopentenylboronic acid pinacol ester, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 1g, 25g, 5g, 10g, 500g.
2-(cyclopenten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 287944-10-9) is a chemical compound with the molecular formula C11H19BO2 and a molecular weight of 194.08 g/mol. IUPAC name: 2-(cyclopenten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JFTZVYKESKQING-UHFFFAOYSA-N.
| Molecular formula | C11H19BO2 |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 2-(cyclopenten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JFTZVYKESKQING-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCC2 |
Computed by PubChem (NCBI)