Products 634196-62-6
CAS 634196-62-6 is the registry number for 1-Pentynylboronic acid pinacol ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
4,4,5,5-tetramethyl-2-pent-1-ynyl-1,3,2-dioxaborolane (CAS 634196-62-6) is a chemical compound with the molecular formula C11H19BO2 and a molecular weight of 194.08 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-pent-1-ynyl-1,3,2-dioxaborolane. InChIKey: RXNSNUUTGWELNS-UHFFFAOYSA-N.
| Molecular formula | C11H19BO2 |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-pent-1-ynyl-1,3,2-dioxaborolane |
| InChIKey | RXNSNUUTGWELNS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C#CCCC |
Computed by PubChem (NCBI)
Synonyms:
1-Pentynylboronic acid pinacol ester, 4,4,5,5-tetramethyl-2-pent-1-ynyl-1,3,2-dioxaborolane, 1-Pentyne-1-boronic Acid Pinacol Ester, RXNSNUUTGWELNS-UHFFFAOYSA-N, 1-Pentynylboronic acid pinacol ester, 1-Pentynylboronic acid pinacol ester 90%, 1-Pentynylboronic acid pinacol ester, 90%, 4,4,5,5-tetramethyl-2-(pent-1-ynyl)-1,3,2-dioxaborolane, 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(1-pentyn-1-yl)-