CAS 1092449-35-8 is the registry number for 2-(2-Cyclopropylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[(E)-2-cyclopropylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1092449-35-8) is a chemical compound with the molecular formula C11H19BO2 and a molecular weight of 194.08 g/mol. IUPAC name: 2-[(E)-2-cyclopropylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FCWYPDPDAZGFRJ-BQYQJAHWSA-N.
| Molecular formula | C11H19BO2 |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 2-[(E)-2-cyclopropylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FCWYPDPDAZGFRJ-BQYQJAHWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2CC2 |
Computed by PubChem (NCBI)