CAS 849061-99-0 appears in our catalog under these names: (E)–2–Cyclopropylvinylboronic acid pinacol ester, (trans)-2-Cyclopropylvinylboronic acid pinacol ester, trans-2-Cyclopropylvinylboronic acid pinacol ester, 97%, 97%, (E)-2-CYCLOPROPYLVINYLBORONIC ACID PINACOL ESTER, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 50g, 100g.
2-[(E)-2-cyclopropylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 849061-99-0) is a chemical compound with the molecular formula C11H19BO2 and a molecular weight of 194.08 g/mol. IUPAC name: 2-[(E)-2-cyclopropylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FCWYPDPDAZGFRJ-BQYQJAHWSA-N.
| Molecular formula | C11H19BO2 |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 2-[(E)-2-cyclopropylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FCWYPDPDAZGFRJ-BQYQJAHWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2CC2 |
Computed by PubChem (NCBI)