cas: 94021-22-4 — see every product listed under this CAS number, including other names
2-(1-Piperazinyl)pyrimidine Dihydrochloride 98% (CAS 94021-22-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A935326-5g |
| cas | 94021-22-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 381.50 Pln | |
| Ambeed | 100g | 960.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A935326 |
2-piperazin-1-ylpyrimidine;dihydrochloride (CAS 94021-22-4) is a chemical compound with the molecular formula C8H14Cl2N4 and a molecular weight of 237.13 g/mol. IUPAC name: 2-piperazin-1-ylpyrimidine;dihydrochloride. InChIKey: ZNZGJSLHXOMREP-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 2-piperazin-1-ylpyrimidine;dihydrochloride |
| InChIKey | ZNZGJSLHXOMREP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)