cas: 94021-22-4 — see every product listed under this CAS number, including other names
2-(1-Piperazinyl)pyrimidine Dihydrochloride, 97%, 97% (CAS 94021-22-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EPP-1g |
| cas | 94021-22-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 203.60 Pln | |
| Chemat | 25g | 314.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-piperazin-1-ylpyrimidine;dihydrochloride (CAS 94021-22-4) is a chemical compound with the molecular formula C8H14Cl2N4 and a molecular weight of 237.13 g/mol. IUPAC name: 2-piperazin-1-ylpyrimidine;dihydrochloride. InChIKey: ZNZGJSLHXOMREP-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 2-piperazin-1-ylpyrimidine;dihydrochloride |
| InChIKey | ZNZGJSLHXOMREP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)