cas: 445303-13-9 — see every product listed under this CAS number, including other names
2-(2,3-Dihydro-1H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 445303-13-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447729-100MG |
| cas | 445303-13-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 622.72 Pln | |
| Fluorochem | 250mg | 997.58 Pln | |
| Fluorochem | 1g | 3012.50 Pln | |
| Fluorochem | 5g | 9171.79 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(2,3-dihydro-1H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 445303-13-9) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 2-(2,3-dihydro-1H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OTCOGJNOBVQVOH-UHFFFAOYSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 2-(2,3-dihydro-1H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OTCOGJNOBVQVOH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(CCC3)C=C2 |
Computed by PubChem (NCBI)