cas: 40101-43-7 — see every product listed under this CAS number, including other names
2-(2,5-Dimethylphenyl)isoindoline-1,3-dione, 98% (CAS 40101-43-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1640867-5g |
| cas | 40101-43-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9210.04 Pln | |
| AmBeed | 10g | 13780.06 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2,5-dimethylphenyl)isoindole-1,3-dione (CAS 40101-43-7) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)isoindole-1,3-dione. InChIKey: ONMMTSFZNQMAGA-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)isoindole-1,3-dione |
| InChIKey | ONMMTSFZNQMAGA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)