cas: 89336-46-9 — see every product listed under this CAS number, including other names
2-(2-((tert-Butoxycarbonyl)amino)thiazol-4-yl)acetic acid 98% (CAS 89336-46-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A462182-1g |
| cas | 89336-46-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 25g | 876.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A462182 |
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid (CAS 89336-46-9) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid. InChIKey: LNUBPLFRRHJPLI-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | LNUBPLFRRHJPLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=CS1)CC(=O)O |
Computed by PubChem (NCBI)