cas: 1047724-24-2 — see every product listed under this CAS number, including other names
2-(2-(Methylsulfonamido)phenyl)acetic acid, >97%, >97% (CAS 1047724-24-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G9N-100mg |
| cas | 1047724-24-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 1g | 947.60 Pln | |
| Chemat | 5g | 2714.00 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
2-[2-(methanesulfonamido)phenyl]acetic acid (CAS 1047724-24-2) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 2-[2-(methanesulfonamido)phenyl]acetic acid. InChIKey: XFQVSOVZZYQXDH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 2-[2-(methanesulfonamido)phenyl]acetic acid |
| InChIKey | XFQVSOVZZYQXDH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=CC=C1CC(=O)O |
Computed by PubChem (NCBI)