CAS 14437-03-7 appears in our catalog under these names: Methyl tosylcarbamate, 95%, Gliclazide Impurity 2 (Methyl Tosylcarbamate), Methyl tosylcarbamate, Methyl Tosylcarbamate, >98.0%(HPLC)(T), Methyl tosylcarbamate, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, on request.
Methyl N-(4-methylphenyl)sulfonylcarbamate (CAS 14437-03-7) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: methyl N-(4-methylphenyl)sulfonylcarbamate. InChIKey: KNVDHKOSDVFZTO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | methyl N-(4-methylphenyl)sulfonylcarbamate |
| InChIKey | KNVDHKOSDVFZTO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)OC |
Computed by PubChem (NCBI)