CAS 59777-72-9 appears in our catalog under these names: 2-Carboethoxybenzene sulfonamide, 98%, Ethyl 2-sulfamoylbenzoate 97%, Ethyl 2-sulfamoylbenzoate, 97%, 97%, Ethyl 2-sulfamoylbenzoate, 98%+,RG, Ethyl 2-sulfamoylbenzoate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 1000g.
Ethyl 2-sulfamoylbenzoate (CAS 59777-72-9) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: ethyl 2-sulfamoylbenzoate. InChIKey: CYFKZTWSLPKROH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | ethyl 2-sulfamoylbenzoate |
| InChIKey | CYFKZTWSLPKROH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC=C1S(=O)(=O)N |
Computed by PubChem (NCBI)