CAS 1612-41-5 appears in our catalog under these names: 1-[(Ethanesulfonyl)methyl]-4-nitrobenzene, 98%, 1-((Ethanesulfonyl)methyl)-4-nitrobenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 25g, 1g, 2,5g.
1-(ethylsulfonylmethyl)-4-nitrobenzene (CAS 1612-41-5) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 1-(ethylsulfonylmethyl)-4-nitrobenzene. InChIKey: QRLVYWVPKPUBJJ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 1-(ethylsulfonylmethyl)-4-nitrobenzene |
| InChIKey | QRLVYWVPKPUBJJ-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)CC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)