CAS 1047724-24-2 appears in our catalog under these names: 2–(2–(Methylsulfonamido)phenyl)acetic Acid, 2-(2-(Methylsulfonamido)phenyl)acetic acid, 2-(2-(Methylsulfonamido)phenyl)acetic acid, 95%, 2-(2-(Methylsulfonamido)phenyl)acetic acid, >97%, >97%. Offered by: GLPBio, Biosynth, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 0,5g, 5g, 100mg.
2-[2-(methanesulfonamido)phenyl]acetic acid (CAS 1047724-24-2) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 2-[2-(methanesulfonamido)phenyl]acetic acid. InChIKey: XFQVSOVZZYQXDH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 2-[2-(methanesulfonamido)phenyl]acetic acid |
| InChIKey | XFQVSOVZZYQXDH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=CC=C1CC(=O)O |
Computed by PubChem (NCBI)