cas: 658076-43-8 — see every product listed under this CAS number, including other names
2-(2-Amino-phenyl)-thiazole-4-carboxylic acid ethyl ester, 95%, 95% (CAS 658076-43-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAKG-100mg |
| cas | 658076-43-8 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 448.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(2-aminophenyl)-1,3-thiazole-4-carboxylate (CAS 658076-43-8) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: ethyl 2-(2-aminophenyl)-1,3-thiazole-4-carboxylate. InChIKey: LQGLQWIYLAHVRF-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | ethyl 2-(2-aminophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | LQGLQWIYLAHVRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC=CC=C2N |
Computed by PubChem (NCBI)