CAS 352454-15-0 appears in our catalog under these names: 3-Amino-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxylic acid, 95%, 3-Amino-5,6,7,8-tetrahydrothieno(2,3-b)quinoline-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxylic acid (CAS 352454-15-0) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: 3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxylic acid. InChIKey: QGKHXXVKKOXGHU-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | 3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxylic acid |
| InChIKey | QGKHXXVKKOXGHU-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC3=C(C=C2C1)C(=C(S3)C(=O)O)N |
Computed by PubChem (NCBI)