CAS 587-14-4 appears in our catalog under these names: N,N'-Diphenylsulfamide, 95%, N,N'-Diphenylsulfamide, 95%+, 95%+. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
N-(phenylsulfamoyl)aniline (CAS 587-14-4) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: N-(phenylsulfamoyl)aniline. InChIKey: ZDZVWJQUOACMTH-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | N-(phenylsulfamoyl)aniline |
| InChIKey | ZDZVWJQUOACMTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)