Products 851468-02-5

CAS 851468-02-5 is the registry number for ([1-(2-Methylphenyl)-1h-imidazol-2-yl]thio)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetic acid (CAS 851468-02-5) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: 2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetic acid. InChIKey: LTJFBTXRNIOGNJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O2S
Molecular weight248.30 g/mol
IUPAC name2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetic acid
InChIKeyLTJFBTXRNIOGNJ-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1N2C=CN=C2SCC(=O)O

Computed by PubChem (NCBI)