CAS 1613051-34-5 is the registry number for (2E)-3-[2,5-Dimethyl-1-(1,3-thiazol-2-yl)-1h-pyrrol-3-yl]acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(E)-3-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]prop-2-enoic acid (CAS 1613051-34-5) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: (E)-3-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]prop-2-enoic acid. InChIKey: XNZHWOUNXNIMSO-ONEGZZNKSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | (E)-3-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]prop-2-enoic acid |
| InChIKey | XNZHWOUNXNIMSO-ONEGZZNKSA-N |
| SMILES | CC1=CC(=C(N1C2=NC=CS2)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)