cas: 958454-33-6 — see every product listed under this CAS number, including other names
2-(2-Bromo-3-fluorophenyl)acetic acid 97% (CAS 958454-33-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A512850-250mg |
| cas | 958454-33-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 10g | 1132.44 Pln | |
| Ambeed | 25g | 2144.81 Pln | |
| Ambeed | 100g | 5932.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A512850 |
2-(2-bromo-3-fluorophenyl)acetic acid (CAS 958454-33-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(2-bromo-3-fluorophenyl)acetic acid. InChIKey: GQCHYZKUKPMGKK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(2-bromo-3-fluorophenyl)acetic acid |
| InChIKey | GQCHYZKUKPMGKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Br)CC(=O)O |
Computed by PubChem (NCBI)