Products 958454-33-6
CAS 958454-33-6 appears in our catalog under these names: 2-Bromo-3-fluorophenylacetic acid, 98%, 2-(2-Bromo-3-fluorophenyl)acetic acid 97%, 2-(2-Bromo-3-fluorophenyl),acetic acid, 97%, 97%, 2-(2-Bromo-3-fluorophenyl)acetic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 250mg, 100g.
2-(2-bromo-3-fluorophenyl)acetic acid (CAS 958454-33-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(2-bromo-3-fluorophenyl)acetic acid. InChIKey: GQCHYZKUKPMGKK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(2-bromo-3-fluorophenyl)acetic acid |
| InChIKey | GQCHYZKUKPMGKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Br)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(2-bromo-3-fluorophenyl)acetic acid, 2-Bromo-3-fluorophenylacetic acid, (2-Bromo-3-fluoro-phenyl)-acetic acid, (2-bromo-3-fluorophenyl)acetic acid, 2-(2-bromo-3-fluoro-phenyl)acetic acid, 2-(2-Bromo-3-fluorophenyl);acetic acid, 2-Bromo-3-fluorophenylaceticacid, 2-Bromo-3-fluorophenylacetic