Products 1379351-68-4
CAS 1379351-68-4 is the registry number for 3-(Bromomethyl)-5-fluorobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-(bromomethyl)-5-fluorobenzoic acid (CAS 1379351-68-4) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 3-(bromomethyl)-5-fluorobenzoic acid. InChIKey: SSVXNXIMHOOTSB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 3-(bromomethyl)-5-fluorobenzoic acid |
| InChIKey | SSVXNXIMHOOTSB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)F)CBr |
Computed by PubChem (NCBI)