cas: 958454-33-6 — see every product listed under this CAS number, including other names
2-(2-Bromo-3-fluorophenyl)acetic acid, 95% (CAS 958454-33-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239346-250MG |
| cas | 958454-33-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 409.25 Pln | |
| Fluorochem | 10g | 758.08 Pln | |
| Fluorochem | 25g | 1419.31 Pln | |
| Fluorochem | 100g | 5298.15 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-bromo-3-fluorophenyl)acetic acid (CAS 958454-33-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(2-bromo-3-fluorophenyl)acetic acid. InChIKey: GQCHYZKUKPMGKK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(2-bromo-3-fluorophenyl)acetic acid |
| InChIKey | GQCHYZKUKPMGKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Br)CC(=O)O |
Computed by PubChem (NCBI)