Products 773100-76-8
CAS 773100-76-8 appears in our catalog under these names: 5-(Bromomethyl)-2-fluorobenzoic acid, 95%, 5-(Bromomethyl)-2-fluorobenzoic Acid, 5-(Bromomethyl)-2-fluorobenzoic acid, 98%, 5-(Bromomethyl)-2-fluorobenzoic acid, 98%,RG, 98%,RG. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 500mg, 10g, 100mg.
5-(bromomethyl)-2-fluorobenzoic acid (CAS 773100-76-8) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 5-(bromomethyl)-2-fluorobenzoic acid. InChIKey: VSGODVJOLOLNMX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 5-(bromomethyl)-2-fluorobenzoic acid |
| InChIKey | VSGODVJOLOLNMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)C(=O)O)F |
Computed by PubChem (NCBI)