CAS 51655-39-1 is the registry number for 2-Bromo-4,5-dimethoxyphenylacetonitrile, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
2-(2-bromo-4,5-dimethoxyphenyl)acetonitrile (CAS 51655-39-1) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 2-(2-bromo-4,5-dimethoxyphenyl)acetonitrile. InChIKey: OYPMCZMEPRFUFJ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 2-(2-bromo-4,5-dimethoxyphenyl)acetonitrile |
| InChIKey | OYPMCZMEPRFUFJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC#N)Br)OC |
Computed by PubChem (NCBI)