CAS 30095-56-8 appears in our catalog under these names: 3'-Acetamido-2-bromoacetophenone, 95%, N-(3-(2-Bromoacetyl)phenyl)acetamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
N-[3-(2-bromoacetyl)phenyl]acetamide (CAS 30095-56-8) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: N-[3-(2-bromoacetyl)phenyl]acetamide. InChIKey: IBMUCSJKSQYUIB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | N-[3-(2-bromoacetyl)phenyl]acetamide |
| InChIKey | IBMUCSJKSQYUIB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1)C(=O)CBr |
Computed by PubChem (NCBI)